![3-[4-(Hydroxymethyl)phenoxy]propanoic acid (CAS: 101366-61-4) - Chemical Structure and Molecular Formula](/static/img/prod_pic/FT-0694595.png "3-[4-(Hydroxymethyl)phenoxy]propanoic acid chemical structure")
3-[4-(Hydroxymethyl)phenoxy]propanoic acid
Catalog No: FT-0694595
CAS No: 101366-61-4
- Chemical Name: 3-[4-(Hydroxymethyl)phenoxy]propanoic acid
- Molecular Formula: C10H12O4
- Molecular Weight: 196.2
- InChI Key: WPWKJUVXEMKOHS-UHFFFAOYSA-N
- InChI: InChI=1S/C10H12O4/c11-7-8-1-3-9(4-2-8)14-6-5-10(12)13/h1-4,11H,5-7H2,(H,12,13)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | GHS07 |
|---|---|
| CAS: | 101366-61-4 |
| Flash_Point: | 146.2ºC |
| Product_Name: | 3-[4-(hydroxymethyl)phenoxy]propanoic acid |
| Bolling_Point: | 365.8ºC at 760mmHg |
| FW: | 196.20000 |
| Melting_Point: | 148-152ºC |
| MF: | C10H12O4 |
| Density: | N/A |
| Melting_Point: | 148-152ºC |
|---|---|
| Vapor_Pressure: | 5.39E-06mmHg at 25°C |
| MF: | C10H12O4 |
| Flash_Point: | 146.2ºC |
| LogP: | 1.03240 |
| Bolling_Point: | 365.8ºC at 760mmHg |
| FW: | 196.20000 |
| PSA: | 66.76000 |
| Exact_Mass: | 196.07400 |
| Symbol: | GHS07 |
|---|---|
| Risk_Statements(EU): | R36/37/38 |
| HS_Code: | 2918990090 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
| RIDADR: | NONH for all modes of transport |
| Hazard_Codes: | Xi: Irritant; |
| Warning_Statement: | P261-P305 + P351 + P338 |
| Safety_Statements: | H315-H319-H335 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)